C14H19N7S — CID 9232122
4-prop-2-enyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 9232122) has the molecular formula C14H19N7S and a molecular weight of 317.42 g/mol. Its IUPAC name is 4-prop-2-enyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-prop-2-enyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9232122 |
| Molecular Formula | C14H19N7S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-prop-2-enyl-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | C=CCn1cnn(CN2CCN(c3ncccn3)CC2)c1=S |
| InChI | InChI=1S/C14H19N7S/c1-2-6-20-11-17-21(14(20)22)12-18-7-9-19(10-8-18)13-15-4-3-5-16-13/h2-5,11H,1,6-10,12H2 |
| InChIKey | RGAYUVVMEOHEJH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 55.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|