C16H20N6O4S2 — CID 24505258
2-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 24505258) has the molecular formula C16H20N6O4S2 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 24505258 |
| Molecular Formula | C16H20N6O4S2 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 2-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1cnn(CN2CCN(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)CC2)c1=S |
| InChI | InChI=1S/C16H20N6O4S2/c1-2-7-19-12-17-21(16(19)27)13-18-8-10-20(11-9-18)28(25,26)15-5-3-14(4-6-15)22(23)24/h2-6,12H,1,7-11,13H2 |
| InChIKey | DCEJPABKDQBJGX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|