C19H29N5O2S2 — CID 9243841
2-[[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 9243841) has the molecular formula C19H29N5O2S2 and a molecular weight of 423.61 g/mol. Its IUPAC name is 2-[[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9243841 |
| Molecular Formula | C19H29N5O2S2 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 2-[[4-[4-[(2R)-butan-2-yl]phenyl]sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CC[C@@H](C)c1ccc(S(=O)(=O)N2CCN(Cn3ncn(CC)c3=S)CC2)cc1 |
| InChI | InChI=1S/C19H29N5O2S2/c1-4-16(3)17-6-8-18(9-7-17)28(25,26)23-12-10-21(11-13-23)15-24-19(27)22(5-2)14-20-24/h6-9,14,16H,4-5,10-13,15H2,1-3H3/t16-/m1/s1 |
| InChIKey | BWHWDQHAYBGFGM-MRXNPFEDSA-N |
| XLogP | 2.91 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|