C13H18ClN5O2S3 — CID 9244184
2-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 9244184) has the molecular formula C13H18ClN5O2S3 and a molecular weight of 407.97 g/mol. Its IUPAC name is 2-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9244184 |
| Molecular Formula | C13H18ClN5O2S3 |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 2-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CCn1cnn(CN2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)c1=S |
| InChI | InChI=1S/C13H18ClN5O2S3/c1-2-17-9-15-19(13(17)22)10-16-5-7-18(8-6-16)24(20,21)12-4-3-11(14)23-12/h3-4,9H,2,5-8,10H2,1H3 |
| InChIKey | BUBPLCYOTCSYDU-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|