C15H21ClN4O4S2 — CID 9244177
(5S)-3-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 9244177) has the molecular formula C15H21ClN4O4S2 and a molecular weight of 420.94 g/mol. Its IUPAC name is (5S)-3-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9244177 |
| Molecular Formula | C15H21ClN4O4S2 |
| Molecular Weight | 420.94 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | (5S)-3-[[4-(5-chlorothiophen-2-yl)sulfonylpiperazin-1-yl]methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCC[C@@H]1NC(=O)N(CN2CCN(S(=O)(=O)c3ccc(Cl)s3)CC2)C1=O |
| InChI | InChI=1S/C15H21ClN4O4S2/c1-2-3-11-14(21)20(15(22)17-11)10-18-6-8-19(9-7-18)26(23,24)13-5-4-12(16)25-13/h4-5,11H,2-3,6-10H2,1H3,(H,17,22)/t11-/m0/s1 |
| InChIKey | KIGZPRSZKAGBJK-NSHDSACASA-N |
| XLogP | 1.39 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.94 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|