C21H25N5O2S2 — CID 27368248
5-methyl-2-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 27368248) has the molecular formula C21H25N5O2S2 and a molecular weight of 443.60 g/mol. Its IUPAC name is 5-methyl-2-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 5-methyl-2-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27368248 |
| Molecular Formula | C21H25N5O2S2 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 5-methyl-2-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(CN2CCN(S(=O)(=O)c3ccc4ccccc4c3)CC2)c1=S |
| InChI | InChI=1S/C21H25N5O2S2/c1-3-10-25-17(2)22-26(21(25)29)16-23-11-13-24(14-12-23)30(27,28)20-9-8-18-6-4-5-7-19(18)15-20/h3-9,15H,1,10-14,16H2,2H3 |
| InChIKey | SHPKJSKHVRDQMF-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|