C23H29N5O2S2 — CID 26941317
4-benzyl-2-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione (PubChem CID 26941317) has the molecular formula C23H29N5O2S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is 4-benzyl-2-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-2-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 26941317 |
| Molecular Formula | C23H29N5O2S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-benzyl-2-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(Cn3nc(C)n(Cc4ccccc4)c3=S)CC2)c1 |
| InChI | InChI=1S/C23H29N5O2S2/c1-18-9-10-19(2)22(15-18)32(29,30)26-13-11-25(12-14-26)17-28-23(31)27(20(3)24-28)16-21-7-5-4-6-8-21/h4-10,15H,11-14,16-17H2,1-3H3 |
| InChIKey | UIUUYFLVSVRSLA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|