C21H23F3N6S — CID 27084693
4-benzyl-5-methyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 27084693) has the molecular formula C21H23F3N6S and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-benzyl-5-methyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-benzyl-5-methyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27084693 |
| Molecular Formula | C21H23F3N6S |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-benzyl-5-methyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(CN2CCN(c3ccc(C(F)(F)F)cn3)CC2)c(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H23F3N6S/c1-16-26-30(20(31)29(16)14-17-5-3-2-4-6-17)15-27-9-11-28(12-10-27)19-8-7-18(13-25-19)21(22,23)24/h2-8,13H,9-12,14-15H2,1H3 |
| InChIKey | UVVXSYGEWRPONS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|