C19H23F3N6S — CID 27084679
5-cyclopropyl-4-prop-2-enyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 27084679) has the molecular formula C19H23F3N6S and a molecular weight of 424.50 g/mol. Its IUPAC name is 5-cyclopropyl-4-prop-2-enyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-cyclopropyl-4-prop-2-enyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27084679 |
| Molecular Formula | C19H23F3N6S |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 5-cyclopropyl-4-prop-2-enyl-2-[[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C2CC2)nn(CN2CCN(c3ccc(C(F)(F)F)cn3)CC2)c1=S |
| InChI | InChI=1S/C19H23F3N6S/c1-2-7-27-17(14-3-4-14)24-28(18(27)29)13-25-8-10-26(11-9-25)16-6-5-15(12-23-16)19(20,21)22/h2,5-6,12,14H,1,3-4,7-11,13H2 |
| InChIKey | OVKPDEINQUNUCR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|