C15H19F3N4O — CID 38522896
N-prop-2-enyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 38522896) has the molecular formula C15H19F3N4O and a molecular weight of 328.34 g/mol. Its IUPAC name is N-prop-2-enyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-prop-2-enyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 38522896 |
| Molecular Formula | C15H19F3N4O |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-prop-2-enyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | C=CCNC(=O)CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H19F3N4O/c1-2-5-19-14(23)11-21-6-8-22(9-7-21)13-4-3-12(10-20-13)15(16,17)18/h2-4,10H,1,5-9,11H2,(H,19,23) |
| InChIKey | VGMHJHXAOPBHHM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|