C22H29F3N4O — CID 9288391
N-(1-adamantyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 9288391) has the molecular formula C22H29F3N4O and a molecular weight of 422.50 g/mol. Its IUPAC name is N-(1-adamantyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-(1-adamantyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9288391 |
| Molecular Formula | C22H29F3N4O |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | N-(1-adamantyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | O=C(CN1CCN(c2ccc(C(F)(F)F)cn2)CC1)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H29F3N4O/c23-22(24,25)18-1-2-19(26-13-18)29-5-3-28(4-6-29)14-20(30)27-21-10-15-7-16(11-21)9-17(8-15)12-21/h1-2,13,15-17H,3-12,14H2,(H,27,30) |
| InChIKey | PDICZZQXBXFPIQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |