C16H23F3N4O — CID 9288574
N-butyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 9288574) has the molecular formula C16H23F3N4O and a molecular weight of 344.38 g/mol. Its IUPAC name is N-butyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 9288574 |
| Molecular Formula | C16H23F3N4O |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | N-butyl-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | CCCCNC(=O)CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H23F3N4O/c1-2-3-6-20-15(24)12-22-7-9-23(10-8-22)14-5-4-13(11-21-14)16(17,18)19/h4-5,11H,2-3,6-10,12H2,1H3,(H,20,24) |
| InChIKey | MCNAVQZJPMEMBT-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|