C22H27F3N4O — CID 42913960
N-(4-butan-2-ylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 42913960) has the molecular formula C22H27F3N4O and a molecular weight of 420.48 g/mol. Its IUPAC name is N-(4-butan-2-ylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-(4-butan-2-ylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 42913960 |
| Molecular Formula | C22H27F3N4O |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.21 |
| IUPAC Name | N-(4-butan-2-ylphenyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)c1ccc(NC(=O)CN2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C22H27F3N4O/c1-3-16(2)17-4-7-19(8-5-17)27-21(30)15-28-10-12-29(13-11-28)20-9-6-18(14-26-20)22(23,24)25/h4-9,14,16H,3,10-13,15H2,1-2H3,(H,27,30) |
| InChIKey | NXUMENAUBDEPHX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |