C16H20F3N5O2 — CID 46802067
N-(prop-2-enylcarbamoyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide (PubChem CID 46802067) has the molecular formula C16H20F3N5O2 and a molecular weight of 371.36 g/mol. Its IUPAC name is N-(prop-2-enylcarbamoyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide.
| Compound Name | N-(prop-2-enylcarbamoyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46802067 |
| Molecular Formula | C16H20F3N5O2 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-(prop-2-enylcarbamoyl)-2-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]acetamide |
| SMILES | C=CCNC(=O)NC(=O)CN1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C16H20F3N5O2/c1-2-5-20-15(26)22-14(25)11-23-6-8-24(9-7-23)13-4-3-12(10-21-13)16(17,18)19/h2-4,10H,1,5-9,11H2,(H2,20,22,25,26) |
| InChIKey | XFYFSWFSOIADAK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|