C20H33N5O3S — CID 55470568
2-[4-[5-[di(propan-2-yl)sulfamoyl]-2-pyridinyl]piperazin-1-yl]-N-prop-2-enylacetamide (PubChem CID 55470568) has the molecular formula C20H33N5O3S and a molecular weight of 423.58 g/mol. Its IUPAC name is 2-[4-[5-[di(propan-2-yl)sulfamoyl]-2-pyridinyl]piperazin-1-yl]-N-prop-2-enylacetamide.
| Compound Name | 2-[4-[5-[di(propan-2-yl)sulfamoyl]-2-pyridinyl]piperazin-1-yl]-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 55470568 |
| Molecular Formula | C20H33N5O3S |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | 2-[4-[5-[di(propan-2-yl)sulfamoyl]-2-pyridinyl]piperazin-1-yl]-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CN1CCN(c2ccc(S(=O)(=O)N(C(C)C)C(C)C)cn2)CC1 |
| InChI | InChI=1S/C20H33N5O3S/c1-6-9-21-20(26)15-23-10-12-24(13-11-23)19-8-7-18(14-22-19)29(27,28)25(16(2)3)17(4)5/h6-8,14,16-17H,1,9-13,15H2,2-5H3,(H,21,26) |
| InChIKey | KBCBZRQPNVAGOA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|