C15H17F3N6O2 — CID 87008630
1-[(5-nitropyrazol-1-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (PubChem CID 87008630) has the molecular formula C15H17F3N6O2 and a molecular weight of 370.34 g/mol. Its IUPAC name is 1-[(5-nitropyrazol-1-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane.
| Compound Name | 1-[(5-nitropyrazol-1-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 87008630 |
| Molecular Formula | C15H17F3N6O2 |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[(5-nitropyrazol-1-yl)methyl]-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccnn1CN1CCCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C15H17F3N6O2/c16-15(17,18)12-2-3-13(19-10-12)22-7-1-6-21(8-9-22)11-23-14(24(25)26)4-5-20-23/h2-5,10H,1,6-9,11H2 |
| InChIKey | UVAACXQUCNQTDE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|