C20H19F3N4O2 — CID 27390427
1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methyl]indole-2,3-dione (PubChem CID 27390427) has the molecular formula C20H19F3N4O2 and a molecular weight of 404.39 g/mol. Its IUPAC name is 1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 27390427 |
| Molecular Formula | C20H19F3N4O2 |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | 1-[[4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepan-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCCN(c3ccc(C(F)(F)F)cn3)CC2)c2ccccc21 |
| InChI | InChI=1S/C20H19F3N4O2/c21-20(22,23)14-6-7-17(24-12-14)26-9-3-8-25(10-11-26)13-27-16-5-2-1-4-15(16)18(28)19(27)29/h1-2,4-7,12H,3,8-11,13H2 |
| InChIKey | PNLFNGSITYMXMZ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|