C17H17F3N4O4S — CID 26532044
1-(2-nitrophenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane (PubChem CID 26532044) has the molecular formula C17H17F3N4O4S and a molecular weight of 430.41 g/mol. Its IUPAC name is 1-(2-nitrophenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane.
| Compound Name | 1-(2-nitrophenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
|---|---|
| PubChem CID | 26532044 |
| Molecular Formula | C17H17F3N4O4S |
| Molecular Weight | 430.41 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | 1-(2-nitrophenyl)sulfonyl-4-[5-(trifluoromethyl)-2-pyridinyl]-1,4-diazepane |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)(=O)N1CCCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C17H17F3N4O4S/c18-17(19,20)13-6-7-16(21-12-13)22-8-3-9-23(11-10-22)29(27,28)15-5-2-1-4-14(15)24(25)26/h1-2,4-7,12H,3,8-11H2 |
| InChIKey | SRUQKPPAVXLSBQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.41 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|