C16H23N5O2S3 — CID 9235540
3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-(methylamino)-1,3,4-thiadiazole-2-thione (PubChem CID 9235540) has the molecular formula C16H23N5O2S3 and a molecular weight of 413.59 g/mol. Its IUPAC name is 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-(methylamino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-(methylamino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9235540 |
| Molecular Formula | C16H23N5O2S3 |
| Molecular Weight | 413.59 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3-[[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]methyl]-5-(methylamino)-1,3,4-thiadiazole-2-thione |
| SMILES | CNc1nn(CN2CCN(S(=O)(=O)c3cc(C)ccc3C)CC2)c(=S)s1 |
| InChI | InChI=1S/C16H23N5O2S3/c1-12-4-5-13(2)14(10-12)26(22,23)20-8-6-19(7-9-20)11-21-16(24)25-15(17-3)18-21/h4-5,10H,6-9,11H2,1-3H3,(H,17,18) |
| InChIKey | XUHBNZHGOXSWAL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.59 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|