C15H21N5O2S3 — CID 9235283
5-(methylamino)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 9235283) has the molecular formula C15H21N5O2S3 and a molecular weight of 399.57 g/mol. Its IUPAC name is 5-(methylamino)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(methylamino)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 9235283 |
| Molecular Formula | C15H21N5O2S3 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 5-(methylamino)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CNc1nn(CN2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)c(=S)s1 |
| InChI | InChI=1S/C15H21N5O2S3/c1-12-3-5-13(6-4-12)25(21,22)19-9-7-18(8-10-19)11-20-15(23)24-14(16-2)17-20/h3-6H,7-11H2,1-2H3,(H,16,17) |
| InChIKey | FGLSBNMSKQCIHF-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|