C17H24FN5O2S3 — CID 24563396
5-(tert-butylamino)-3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione (PubChem CID 24563396) has the molecular formula C17H24FN5O2S3 and a molecular weight of 445.61 g/mol. Its IUPAC name is 5-(tert-butylamino)-3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione.
| Compound Name | 5-(tert-butylamino)-3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 24563396 |
| Molecular Formula | C17H24FN5O2S3 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | 5-(tert-butylamino)-3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-1,3,4-thiadiazole-2-thione |
| SMILES | CC(C)(C)Nc1nn(CN2CCN(S(=O)(=O)c3cccc(F)c3)CC2)c(=S)s1 |
| InChI | InChI=1S/C17H24FN5O2S3/c1-17(2,3)19-15-20-23(16(26)27-15)12-21-7-9-22(10-8-21)28(24,25)14-6-4-5-13(18)11-14/h4-6,11H,7-10,12H2,1-3H3,(H,19,20) |
| InChIKey | KCPWITJSTJDABK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|