C21H23FN4O4S — CID 46697324
3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione (PubChem CID 46697324) has the molecular formula C21H23FN4O4S and a molecular weight of 446.50 g/mol. Its IUPAC name is 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46697324 |
| Molecular Formula | C21H23FN4O4S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 3-[[4-(3-fluorophenyl)sulfonylpiperazin-1-yl]methyl]-5-methyl-1-phenylimidazolidine-2,4-dione |
| SMILES | CC1C(=O)N(CN2CCN(S(=O)(=O)c3cccc(F)c3)CC2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C21H23FN4O4S/c1-16-20(27)25(21(28)26(16)18-7-3-2-4-8-18)15-23-10-12-24(13-11-23)31(29,30)19-9-5-6-17(22)14-19/h2-9,14,16H,10-13,15H2,1H3 |
| InChIKey | CILKRBJZGGZKFV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|