C22H21N3O4S — CID 2497260
3-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzoxazol-2-one (PubChem CID 2497260) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzoxazol-2-one.
| Compound Name | 3-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 2497260 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-[(4-naphthalen-2-ylsulfonylpiperazin-1-yl)methyl]-1,3-benzoxazol-2-one |
| SMILES | O=c1oc2ccccc2n1CN1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H21N3O4S/c26-22-25(20-7-3-4-8-21(20)29-22)16-23-11-13-24(14-12-23)30(27,28)19-10-9-17-5-1-2-6-18(17)15-19/h1-10,15H,11-14,16H2 |
| InChIKey | LITQSWHNJLXYFG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 75.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |