C17H20N6O2S2 — CID 9240005
2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 9240005) has the molecular formula C17H20N6O2S2 and a molecular weight of 404.52 g/mol. Its IUPAC name is 2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 9240005 |
| Molecular Formula | C17H20N6O2S2 |
| Molecular Weight | 404.52 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | 2-[4-[(4-prop-2-enyl-5-sulfanylidene-1,2,4-triazol-1-yl)methyl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | C=CCn1cnn(CN2CCN(S(=O)(=O)c3ccccc3C#N)CC2)c1=S |
| InChI | InChI=1S/C17H20N6O2S2/c1-2-7-21-13-19-23(17(21)26)14-20-8-10-22(11-9-20)27(24,25)16-6-4-3-5-15(16)12-18/h2-6,13H,1,7-11,14H2 |
| InChIKey | RSEGZVSSUUOMTC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 87.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|