C17H18N4O2S — CID 38506453
2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 38506453) has the molecular formula C17H18N4O2S and a molecular weight of 342.42 g/mol. Its IUPAC name is 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 38506453 |
| Molecular Formula | C17H18N4O2S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[4-(pyridin-3-ylmethyl)piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)N1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C17H18N4O2S/c18-12-16-5-1-2-6-17(16)24(22,23)21-10-8-20(9-11-21)14-15-4-3-7-19-13-15/h1-7,13H,8-11,14H2 |
| InChIKey | DFNWQHUTFTVQIR-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |