C25H31N5O3S — CID 4839964
2-[4-[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl]piperazin-1-yl]sulfonylbenzonitrile (PubChem CID 4839964) has the molecular formula C25H31N5O3S and a molecular weight of 481.62 g/mol. Its IUPAC name is 2-[4-[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl]piperazin-1-yl]sulfonylbenzonitrile.
| Compound Name | 2-[4-[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl]piperazin-1-yl]sulfonylbenzonitrile |
|---|---|
| PubChem CID | 4839964 |
| Molecular Formula | C25H31N5O3S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[4-[1-(4-benzylpiperazin-1-yl)-1-oxopropan-2-yl]piperazin-1-yl]sulfonylbenzonitrile |
| SMILES | CC(C(=O)N1CCN(Cc2ccccc2)CC1)N1CCN(S(=O)(=O)c2ccccc2C#N)CC1 |
| InChI | InChI=1S/C25H31N5O3S/c1-21(25(31)29-13-11-27(12-14-29)20-22-7-3-2-4-8-22)28-15-17-30(18-16-28)34(32,33)24-10-6-5-9-23(24)19-26/h2-10,21H,11-18,20H2,1H3 |
| InChIKey | PCZQDPZKLJSKBS-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 87.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |