C21H25N5O5S — CID 167909863
1-[[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile (PubChem CID 167909863) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is 1-[[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 167909863 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[[4-(4-tert-butylphenyl)sulfonylpiperazin-1-yl]methyl]-5-nitro-2-oxopyridine-3-carbonitrile |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)N2CCN(Cn3cc([N+](=O)[O-])cc(C#N)c3=O)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O5S/c1-21(2,3)17-4-6-19(7-5-17)32(30,31)25-10-8-23(9-11-25)15-24-14-18(26(28)29)12-16(13-22)20(24)27/h4-7,12,14H,8-11,15H2,1-3H3 |
| InChIKey | CRHGBKQKAJHCPC-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|