C26H26F3N3O5S — CID 126651868
1,1,1-trifluoro-2-[4-[4-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 126651868) has the molecular formula C26H26F3N3O5S and a molecular weight of 549.57 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[4-[4-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[4-[4-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 126651868 |
| Molecular Formula | C26H26F3N3O5S |
| Molecular Weight | 549.57 g/mol |
| Exact Mass | 549.15 |
| IUPAC Name | 1,1,1-trifluoro-2-[4-[4-[[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | CC(O)(c1ccc(-c2ccc(CN3CCN(S(=O)(=O)c4ccc([N+](=O)[O-])cc4)CC3)cc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C26H26F3N3O5S/c1-25(33,26(27,28)29)22-8-6-21(7-9-22)20-4-2-19(3-5-20)18-30-14-16-31(17-15-30)38(36,37)24-12-10-23(11-13-24)32(34)35/h2-13,33H,14-18H2,1H3 |
| InChIKey | PNCOTFBUNRYZCL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.57 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|