C19H17F6N3O5S — CID 86670361
1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 86670361) has the molecular formula C19H17F6N3O5S and a molecular weight of 513.42 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 86670361 |
| Molecular Formula | C19H17F6N3O5S |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H17F6N3O5S/c20-18(21,22)17(29,19(23,24)25)13-1-3-14(4-2-13)26-9-11-27(12-10-26)34(32,33)16-7-5-15(6-8-16)28(30)31/h1-8,29H,9-12H2 |
| InChIKey | RNURVCYJQWBIRI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|