C20H22F3N3O5S — CID 23648604
(2S)-1,1,1-trifluoro-2-[4-[(2R)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]propan-2-ol (PubChem CID 23648604) has the molecular formula C20H22F3N3O5S and a molecular weight of 473.47 g/mol. Its IUPAC name is (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]propan-2-ol.
| Compound Name | (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 23648604 |
| Molecular Formula | C20H22F3N3O5S |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (2S)-1,1,1-trifluoro-2-[4-[(2R)-2-methyl-4-(4-nitrophenyl)piperazin-1-yl]sulfonylphenyl]propan-2-ol |
| SMILES | C[C@@H]1CN(c2ccc([N+](=O)[O-])cc2)CCN1S(=O)(=O)c1ccc([C@](C)(O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3N3O5S/c1-14-13-24(16-5-7-17(8-6-16)26(28)29)11-12-25(14)32(30,31)18-9-3-15(4-10-18)19(2,27)20(21,22)23/h3-10,14,27H,11-13H2,1-2H3/t14-,19+/m1/s1 |
| InChIKey | GQVFDHMYMMTQKL-KUHUBIRLSA-N |
| XLogP | 3.26 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|