C17H15F6N3O5S2 — CID 86670373
1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol (PubChem CID 86670373) has the molecular formula C17H15F6N3O5S2 and a molecular weight of 519.45 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 86670373 |
| Molecular Formula | C17H15F6N3O5S2 |
| Molecular Weight | 519.45 g/mol |
| Exact Mass | 519.04 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-(4-nitrothiophen-2-yl)sulfonylpiperazin-1-yl]phenyl]propan-2-ol |
| SMILES | O=[N+]([O-])c1csc(S(=O)(=O)N2CCN(c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)c1 |
| InChI | InChI=1S/C17H15F6N3O5S2/c18-16(19,20)15(27,17(21,22)23)11-1-3-12(4-2-11)24-5-7-25(8-6-24)33(30,31)14-9-13(10-32-14)26(28)29/h1-4,9-10,27H,5-8H2 |
| InChIKey | FMFKQNUJOKINMC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 103.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|