C18H22N8OS — CID 2454380
1-(2-methoxy-5-methylphenyl)-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]tetrazole-5-thione (PubChem CID 2454380) has the molecular formula C18H22N8OS and a molecular weight of 398.50 g/mol. Its IUPAC name is 1-(2-methoxy-5-methylphenyl)-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]tetrazole-5-thione.
| Compound Name | 1-(2-methoxy-5-methylphenyl)-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]tetrazole-5-thione |
|---|---|
| PubChem CID | 2454380 |
| Molecular Formula | C18H22N8OS |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 1-(2-methoxy-5-methylphenyl)-4-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]tetrazole-5-thione |
| SMILES | COc1ccc(C)cc1-n1nnn(CN2CCN(c3ncccn3)CC2)c1=S |
| InChI | InChI=1S/C18H22N8OS/c1-14-4-5-16(27-2)15(12-14)26-18(28)25(21-22-26)13-23-8-10-24(11-9-23)17-19-6-3-7-20-17/h3-7,12H,8-11,13H2,1-2H3 |
| InChIKey | ZGNUDVDSTNUMQB-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 77.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|