C25H26FN7OS — CID 26939336
5-(4-ethoxyphenyl)-4-(2-fluorophenyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione (PubChem CID 26939336) has the molecular formula C25H26FN7OS and a molecular weight of 491.60 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-4-(2-fluorophenyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-ethoxyphenyl)-4-(2-fluorophenyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 26939336 |
| Molecular Formula | C25H26FN7OS |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.19 |
| IUPAC Name | 5-(4-ethoxyphenyl)-4-(2-fluorophenyl)-2-[(4-pyrimidin-2-ylpiperazin-1-yl)methyl]-1,2,4-triazole-3-thione |
| SMILES | CCOc1ccc(-c2nn(CN3CCN(c4ncccn4)CC3)c(=S)n2-c2ccccc2F)cc1 |
| InChI | InChI=1S/C25H26FN7OS/c1-2-34-20-10-8-19(9-11-20)23-29-32(25(35)33(23)22-7-4-3-6-21(22)26)18-30-14-16-31(17-15-30)24-27-12-5-13-28-24/h3-13H,2,14-18H2,1H3 |
| InChIKey | CBRKSXQYHXJMLB-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 64.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|