C28H30ClN5OS — CID 56935132
5-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(4-ethylpiperazin-1-yl)methyl]-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 56935132) has the molecular formula C28H30ClN5OS and a molecular weight of 520.10 g/mol. Its IUPAC name is 5-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(4-ethylpiperazin-1-yl)methyl]-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 5-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(4-ethylpiperazin-1-yl)methyl]-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 56935132 |
| Molecular Formula | C28H30ClN5OS |
| Molecular Weight | 520.10 g/mol |
| Exact Mass | 519.19 |
| IUPAC Name | 5-[4-[(2-chlorophenyl)methoxy]phenyl]-2-[(4-ethylpiperazin-1-yl)methyl]-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | CCN1CCN(Cn2nc(-c3ccc(OCc4ccccc4Cl)cc3)n(-c3ccccc3)c2=S)CC1 |
| InChI | InChI=1S/C28H30ClN5OS/c1-2-31-16-18-32(19-17-31)21-33-28(36)34(24-9-4-3-5-10-24)27(30-33)22-12-14-25(15-13-22)35-20-23-8-6-7-11-26(23)29/h3-15H,2,16-21H2,1H3 |
| InChIKey | UWVDFPBKJYNGHE-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 38.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.10 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|