C19H20N4OS — CID 980223
2-(morpholin-4-ylmethyl)-4,5-diphenyl-1,2,4-triazole-3-thione (PubChem CID 980223) has the molecular formula C19H20N4OS and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-4,5-diphenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-(morpholin-4-ylmethyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 980223 |
| Molecular Formula | C19H20N4OS |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-4,5-diphenyl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCOCC2)nc(-c2ccccc2)n1-c1ccccc1 |
| InChI | InChI=1S/C19H20N4OS/c25-19-22(15-21-11-13-24-14-12-21)20-18(16-7-3-1-4-8-16)23(19)17-9-5-2-6-10-17/h1-10H,11-15H2 |
| InChIKey | MUAHUPOLCKKITO-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 35.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|