C19H21N5O2S — CID 14784001
4-(4-methoxyphenyl)-2-(morpholin-4-ylmethyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 14784001) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-(morpholin-4-ylmethyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 4-(4-methoxyphenyl)-2-(morpholin-4-ylmethyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 14784001 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-(morpholin-4-ylmethyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-n2c(-c3ccncc3)nn(CN3CCOCC3)c2=S)cc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-25-17-4-2-16(3-5-17)24-18(15-6-8-20-9-7-15)21-23(19(24)27)14-22-10-12-26-13-11-22/h2-9H,10-14H2,1H3 |
| InChIKey | SHRGENCQSIXRPI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|