C23H21N5OS — CID 78905536
2-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylmethyl)-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 78905536) has the molecular formula C23H21N5OS and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylmethyl)-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylmethyl)-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 78905536 |
| Molecular Formula | C23H21N5OS |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 2-(3,5-dihydro-2H-1,4-benzoxazepin-4-ylmethyl)-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCOc3ccccc3C2)nc(-c2ccncc2)n1-c1ccccc1 |
| InChI | InChI=1S/C23H21N5OS/c30-23-27(17-26-14-15-29-21-9-5-4-6-19(21)16-26)25-22(18-10-12-24-13-11-18)28(23)20-7-2-1-3-8-20/h1-13H,14-17H2 |
| InChIKey | AXRKISXBRWJWIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|