C19H21N5OS — CID 17461908
2-[(2-methylmorpholin-4-yl)methyl]-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 17461908) has the molecular formula C19H21N5OS and a molecular weight of 367.48 g/mol. Its IUPAC name is 2-[(2-methylmorpholin-4-yl)methyl]-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(2-methylmorpholin-4-yl)methyl]-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 17461908 |
| Molecular Formula | C19H21N5OS |
| Molecular Weight | 367.48 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[(2-methylmorpholin-4-yl)methyl]-4-phenyl-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | CC1CN(Cn2nc(-c3ccncc3)n(-c3ccccc3)c2=S)CCO1 |
| InChI | InChI=1S/C19H21N5OS/c1-15-13-22(11-12-25-15)14-23-19(26)24(17-5-3-2-4-6-17)18(21-23)16-7-9-20-10-8-16/h2-10,15H,11-14H2,1H3 |
| InChIKey | BGBLTFFWZBMPFQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|