C25H25ClN6S — CID 2454453
2-[(4-benzylpiperazin-1-yl)methyl]-4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 2454453) has the molecular formula C25H25ClN6S and a molecular weight of 477.04 g/mol. Its IUPAC name is 2-[(4-benzylpiperazin-1-yl)methyl]-4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 2454453 |
| Molecular Formula | C25H25ClN6S |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 2-[(4-benzylpiperazin-1-yl)methyl]-4-(4-chlorophenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCN(Cc3ccccc3)CC2)nc(-c2ccncc2)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN6S/c26-22-6-8-23(9-7-22)32-24(21-10-12-27-13-11-21)28-31(25(32)33)19-30-16-14-29(15-17-30)18-20-4-2-1-3-5-20/h1-13H,14-19H2 |
| InChIKey | KAHZQMCZHCLETR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|