C24H23N5OS — CID 27365530
2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione (PubChem CID 27365530) has the molecular formula C24H23N5OS and a molecular weight of 429.55 g/mol. Its IUPAC name is 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione.
| Compound Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27365530 |
| Molecular Formula | C24H23N5OS |
| Molecular Weight | 429.55 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 2-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-4-(4-methoxyphenyl)-5-pyridin-4-yl-1,2,4-triazole-3-thione |
| SMILES | COc1ccc(-n2c(-c3ccncc3)nn(CN3CCc4ccccc4C3)c2=S)cc1 |
| InChI | InChI=1S/C24H23N5OS/c1-30-22-8-6-21(7-9-22)29-23(19-10-13-25-14-11-19)26-28(24(29)31)17-27-15-12-18-4-2-3-5-20(18)16-27/h2-11,13-14H,12,15-17H2,1H3 |
| InChIKey | ZJUZASHLKGVTCT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 48.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|