C18H24ClN5O2S — CID 134121468
5-(4-chlorophenyl)-2,4-bis(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione (PubChem CID 134121468) has the molecular formula C18H24ClN5O2S and a molecular weight of 409.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2,4-bis(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-chlorophenyl)-2,4-bis(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 134121468 |
| Molecular Formula | C18H24ClN5O2S |
| Molecular Weight | 409.94 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-(4-chlorophenyl)-2,4-bis(morpholin-4-ylmethyl)-1,2,4-triazole-3-thione |
| SMILES | S=c1n(CN2CCOCC2)nc(-c2ccc(Cl)cc2)n1CN1CCOCC1 |
| InChI | InChI=1S/C18H24ClN5O2S/c19-16-3-1-15(2-4-16)17-20-24(14-22-7-11-26-12-8-22)18(27)23(17)13-21-5-9-25-10-6-21/h1-4H,5-14H2 |
| InChIKey | KEYQPMCLEQSFEE-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 47.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.94 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|