C19H26ClN5O2S2 — CID 42933978
5-(4-chlorophenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione (PubChem CID 42933978) has the molecular formula C19H26ClN5O2S2 and a molecular weight of 456.04 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione.
| Compound Name | 5-(4-chlorophenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 42933978 |
| Molecular Formula | C19H26ClN5O2S2 |
| Molecular Weight | 456.04 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 5-(4-chlorophenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-4-ethyl-1,2,4-triazole-3-thione |
| SMILES | CCn1c(-c2ccc(Cl)cc2)nn(CN2CCN(C3CCS(=O)(=O)C3)CC2)c1=S |
| InChI | InChI=1S/C19H26ClN5O2S2/c1-2-24-18(15-3-5-16(20)6-4-15)21-25(19(24)28)14-22-8-10-23(11-9-22)17-7-12-29(26,27)13-17/h3-6,17H,2,7-14H2,1H3 |
| InChIKey | FRDAEYLRVSWFKF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.04 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|