C19H27N5O2S2 — CID 30670704
2-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-(4-ethylphenyl)-1H-1,2,4-triazole-3-thione (PubChem CID 30670704) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-(4-ethylphenyl)-1H-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-(4-ethylphenyl)-1H-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30670704 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 2-[[4-[(3R)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-(4-ethylphenyl)-1H-1,2,4-triazole-3-thione |
| SMILES | CCc1ccc(-c2nc(=S)n(CN3CCN([C@@H]4CCS(=O)(=O)C4)CC3)[nH]2)cc1 |
| InChI | InChI=1S/C19H27N5O2S2/c1-2-15-3-5-16(6-4-15)18-20-19(27)24(21-18)14-22-8-10-23(11-9-22)17-7-12-28(25,26)13-17/h3-6,17H,2,7-14H2,1H3,(H,20,21,27)/t17-/m1/s1 |
| InChIKey | KRFQPMBJASFMDU-QGZVFWFLSA-N |
| XLogP | 1.93 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|