C17H22N4O2S2 — CID 9233566
methyl (2S)-4-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]thiomorpholine-2-carboxylate (PubChem CID 9233566) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is methyl (2S)-4-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]thiomorpholine-2-carboxylate.
| Compound Name | methyl (2S)-4-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]thiomorpholine-2-carboxylate |
|---|---|
| PubChem CID | 9233566 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | methyl (2S)-4-[[5-(4-ethylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]thiomorpholine-2-carboxylate |
| SMILES | CCc1ccc(-c2nc(=S)n(CN3CCS[C@H](C(=O)OC)C3)[nH]2)cc1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-3-12-4-6-13(7-5-12)15-18-17(24)21(19-15)11-20-8-9-25-14(10-20)16(22)23-2/h4-7,14H,3,8-11H2,1-2H3,(H,18,19,24)/t14-/m0/s1 |
| InChIKey | UHDQTBJWBFTLOQ-AWEZNQCLSA-N |
| XLogP | 2.72 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|