C18H25N5O2S2 — CID 30670659
2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione (PubChem CID 30670659) has the molecular formula C18H25N5O2S2 and a molecular weight of 407.57 g/mol. Its IUPAC name is 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30670659 |
| Molecular Formula | C18H25N5O2S2 |
| Molecular Weight | 407.57 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-5-methyl-4-phenyl-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(CN2CCN([C@H]3CCS(=O)(=O)C3)CC2)c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C18H25N5O2S2/c1-15-19-22(18(26)23(15)16-5-3-2-4-6-16)14-20-8-10-21(11-9-20)17-7-12-27(24,25)13-17/h2-6,17H,7-14H2,1H3/t17-/m0/s1 |
| InChIKey | LIUJGJFBBOGTOU-KRWDZBQOSA-N |
| XLogP | 1.47 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|