C15H21N5O2S2 — CID 92763186
2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 92763186) has the molecular formula C15H21N5O2S2 and a molecular weight of 367.50 g/mol. Its IUPAC name is 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 92763186 |
| Molecular Formula | C15H21N5O2S2 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | O=S1(=O)CC[C@H](N2CCN(Cn3nc4ccccn4c3=S)CC2)C1 |
| InChI | InChI=1S/C15H21N5O2S2/c21-24(22)10-4-13(11-24)18-8-6-17(7-9-18)12-20-15(23)19-5-2-1-3-14(19)16-20/h1-3,5,13H,4,6-12H2/t13-/m0/s1 |
| InChIKey | ABUCMSPVLJENKS-ZDUSSCGKSA-N |
| XLogP | 0.63 |
| TPSA | 62.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|