C19H27N5O2S2 — CID 18273459
4-(2,4-dimethylphenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione (PubChem CID 18273459) has the molecular formula C19H27N5O2S2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 4-(2,4-dimethylphenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione.
| Compound Name | 4-(2,4-dimethylphenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 18273459 |
| Molecular Formula | C19H27N5O2S2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-(2,4-dimethylphenyl)-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-n2cnn(CN3CCN(C4CCS(=O)(=O)C4)CC3)c2=S)c(C)c1 |
| InChI | InChI=1S/C19H27N5O2S2/c1-15-3-4-18(16(2)11-15)23-13-20-24(19(23)27)14-21-6-8-22(9-7-21)17-5-10-28(25,26)12-17/h3-4,11,13,17H,5-10,12,14H2,1-2H3 |
| InChIKey | IIZXZGPIOBLVAN-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|