About 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one
4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one (PubChem CID 22829830) has the molecular formula C13H18Cl2N4O3S
and a molecular weight of 381.29 g/mol. Its IUPAC name is 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one |
| PubChem CID | 22829830 |
| Molecular Formula | C13H18Cl2N4O3S |
| Molecular Weight | 381.29 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1CN1CCN(C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C13H18Cl2N4O3S/c14-11-7-16-19(13(20)12(11)15)9-17-2-4-18(5-3-17)10-1-6-23(21,22)8-10/h7,10H,1-6,8-9H2 |
| InChIKey | UFPCDMOFWYCHSO-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one?
The IUPAC name of 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one (CID 22829830) is 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one.
What is the SMILES notation for 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one?
The canonical SMILES for 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one is O=c1c(Cl)c(Cl)cnn1CN1CCN(C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one?
The InChIKey is UFPCDMOFWYCHSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18Cl2N4O3S/c14-11-7-16-19(13(20)12(11)15)9-17-2-4-18(5-3-17)10-1-6-23(21,22)8-10/h7,10H,1-6,8-9H2.
What are the key properties of 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one?
4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one has a molecular weight of 381.29 g/mol, XLogP of 0.31, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dichloro-2-[[4-(1,1-dioxothiolan-3-yl)piperazin-1-yl]methyl]pyridazin-3-one is sourced from PubChem (CID 22829830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).