C25H31N5O2S2 — CID 30635627
2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-4,5-bis(4-methylphenyl)-1,2,4-triazole-3-thione (PubChem CID 30635627) has the molecular formula C25H31N5O2S2 and a molecular weight of 497.69 g/mol. Its IUPAC name is 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-4,5-bis(4-methylphenyl)-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-4,5-bis(4-methylphenyl)-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 30635627 |
| Molecular Formula | C25H31N5O2S2 |
| Molecular Weight | 497.69 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[[4-[(3S)-1,1-dioxothiolan-3-yl]piperazin-1-yl]methyl]-4,5-bis(4-methylphenyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1ccc(-c2nn(CN3CCN([C@H]4CCS(=O)(=O)C4)CC3)c(=S)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C25H31N5O2S2/c1-19-3-7-21(8-4-19)24-26-29(25(33)30(24)22-9-5-20(2)6-10-22)18-27-12-14-28(15-13-27)23-11-16-34(31,32)17-23/h3-10,23H,11-18H2,1-2H3/t23-/m0/s1 |
| InChIKey | IQAQCPKBSPJUGK-QHCPKHFHSA-N |
| XLogP | 3.45 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.69 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|