C28H29N5OS — CID 26000617
N-[1-[[4-(4-methylphenyl)-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide (PubChem CID 26000617) has the molecular formula C28H29N5OS and a molecular weight of 483.64 g/mol. Its IUPAC name is N-[1-[[4-(4-methylphenyl)-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[[4-(4-methylphenyl)-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 26000617 |
| Molecular Formula | C28H29N5OS |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | N-[1-[[4-(4-methylphenyl)-3-phenyl-5-sulfanylidene-1,2,4-triazol-1-yl]methyl]piperidin-4-yl]benzamide |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nn(CN3CCC(NC(=O)c4ccccc4)CC3)c2=S)cc1 |
| InChI | InChI=1S/C28H29N5OS/c1-21-12-14-25(15-13-21)33-26(22-8-4-2-5-9-22)30-32(28(33)35)20-31-18-16-24(17-19-31)29-27(34)23-10-6-3-7-11-23/h2-15,24H,16-20H2,1H3,(H,29,34) |
| InChIKey | BPBHOOQQMIYXAJ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 55.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|